cas: 1415740-83-8 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate, 95%, 95% (CAS 1415740-83-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HW3T-100mg |
| cas | 1415740-83-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1048.40 Pln | |
| Chemat | 10g | 8786.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate (CAS 1415740-83-8) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate. InChIKey: MVHJLPVFTFKCGA-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate |
| InChIKey | MVHJLPVFTFKCGA-UHFFFAOYSA-N |
| SMILES | CC1CC(CCN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)