CAS 1415740-83-8 appears in our catalog under these names: 1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate, 96%, N-Boc-2-methyl-1,4-piperidinedicarboxylic Acid Methyl Ester, 1-tert-Butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate 96%, 1-tert-Butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g, 100mg.
1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate (CAS 1415740-83-8) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate. InChIKey: MVHJLPVFTFKCGA-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate |
| InChIKey | MVHJLPVFTFKCGA-UHFFFAOYSA-N |
| SMILES | CC1CC(CCN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)