cas: 261-96-1 — see every product listed under this CAS number, including other names
10H-Benzo[b]pyrido[2,3-e][1,4]thiazine 97% (CAS 261-96-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A509943-250mg |
| cas | 261-96-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 25g | 726.38 Pln | |
| Ambeed | 100g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A509943 |
10H-pyrido[3,2-b][1,4]benzothiazine (CAS 261-96-1) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 10H-pyrido[3,2-b][1,4]benzothiazine. InChIKey: UKDZROJJLPDLDO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 10H-pyrido[3,2-b][1,4]benzothiazine |
| InChIKey | UKDZROJJLPDLDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC=N3 |
Computed by PubChem (NCBI)