cas: 81-86-7 — see every product listed under this CAS number, including other names
1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-bromo-, 95% (CAS 81-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ID6N-100g |
| cas | 81-86-7 |
| size | 100g |
| availability | 50000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 88.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 81-86-7) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: DTUOTSLAFJCQHN-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)