6-Bromobenzo[de]isochromene-1,3-dione 95%
cas: 81-86-7 — see every product listed under this CAS number, including other names
6-Bromobenzo[de]isochromene-1,3-dione 95% (CAS 81-86-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202986-5g |
| cas | 81-86-7 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 253.56 Pln | |
| Ambeed | 500g | 459.38 Pln | |
| Ambeed | 1000g | 743.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202986 |
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 81-86-7) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: DTUOTSLAFJCQHN-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-1,8-naphthalic anhydride, 1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-bromo-, 6-bromo-1h,3h-naphtho[1,8-cd]pyran-1,3-dione, 1H,3H-Naphtho(1,8-cd)pyran-1,3-dione, 6-bromo-, 6-Bromo-1H,3H-naphtho(1,8-cd)pyran-1,3-dione, 6-Bromobenzo[de]isochromene-1,3-dione, 4-Bromo-1,8-naphthalenedicarboxylic Anhydride, 6-Bromo-1H,3H-benzo[de]isochromene-1,3-dione, 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione, 6-bromo-1H,3H-naphtho[l,8-cd]pyran-1,3-dione