cas: 81-86-7 — see every product listed under this CAS number, including other names
4-Bromo-1,8-naphthalic Anhydride, >95.0%(T) (CAS 81-86-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0858-5G |
| cas | 81-86-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 142.93 Pln | |
| TCI | 25g | 457.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 81-86-7) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: DTUOTSLAFJCQHN-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)