cas: 81-86-7 — see every product listed under this CAS number, including other names
4-Bromo-1,8-naphthalic anhydride, 95% (CAS 81-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 10g. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OS-7831-100g |
| cas | 81-86-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1kg | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Sigma-Aldrich | 5G | 360.00 Pln | |
| Fluorochem | 100g | 122.89 Pln | |
| Fluorochem | 5g | 81.24 Pln | |
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 91.65 Pln | |
| Fluorochem | 500g | 294.71 Pln | |
| Fluorochem | 1kg | 534.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 81-86-7) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: DTUOTSLAFJCQHN-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)