cas: 81-86-7 — see every product listed under this CAS number, including other names
1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-bromo-, 98%, 98% (CAS 81-86-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1kg, 5kg, 10kg, 25kg, 5g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ID6N-10g |
| cas | 81-86-7 |
| size | 10g |
| availability | 50000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 1kg | 438.80 Pln | |
| Chemat | 5kg | 2491.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| Chemat | 5g | 69.20 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 500g | 264.00 Pln | |
| Chemat | 50kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 81-86-7) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: DTUOTSLAFJCQHN-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)