cas: 885068-10-0 — see every product listed under this CAS number, including other names
1H-Indazol-6-yl-6-boronic acid, 97% (CAS 885068-10-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091520-1G |
| cas | 885068-10-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 1185.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1H-indazol-6-ylboronic acid (CAS 885068-10-0) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-6-ylboronic acid. InChIKey: ZKNLCHWRWRYPGG-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-6-ylboronic acid |
| InChIKey | ZKNLCHWRWRYPGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NN2)(O)O |
Computed by PubChem (NCBI)