cas: 885068-10-0 — see every product listed under this CAS number, including other names
1H-Indazol-6-ylboronic acid, 97%, 97% (CAS 885068-10-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N9V-250mg |
| cas | 885068-10-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 890.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1H-indazol-6-ylboronic acid (CAS 885068-10-0) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-6-ylboronic acid. InChIKey: ZKNLCHWRWRYPGG-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-6-ylboronic acid |
| InChIKey | ZKNLCHWRWRYPGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NN2)(O)O |
Computed by PubChem (NCBI)