cas: 1001412-59-4 — see every product listed under this CAS number, including other names
1H-Pyrrolo(2,3-b)pyridine-3-sulfonyl chloride, 98% (CAS 1001412-59-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A675670-1g |
| cas | 1001412-59-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 1001412-59-4) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: CNZIHLRMHLLIJQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | CNZIHLRMHLLIJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2S(=O)(=O)Cl)N=C1 |
Computed by PubChem (NCBI)