cas: 1001412-59-4 — see every product listed under this CAS number, including other names
1H-Pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%, 95% (CAS 1001412-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11123H-100mg |
| cas | 1001412-59-4 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 1001412-59-4) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: CNZIHLRMHLLIJQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | CNZIHLRMHLLIJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2S(=O)(=O)Cl)N=C1 |
Computed by PubChem (NCBI)