cas: 198205-79-7 — see every product listed under this CAS number, including other names
2'-(Trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid 95% (CAS 198205-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298667-250mg |
| cas | 198205-79-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 748.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298667 |
4-[2-(trifluoromethyl)phenyl]benzoic acid (CAS 198205-79-7) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]benzoic acid. InChIKey: WQKDEUGMDSTMAK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | WQKDEUGMDSTMAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)