cas: 50-89-5 — see every product listed under this CAS number, including other names
2'-Deoxythymidine, 99%, 99% (CAS 50-89-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112P86-5g |
| cas | 50-89-5 |
| size | 5g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 500g | 374.40 Pln | |
| Chemat | 5kg | 3278.40 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 250g | 184.40 Pln | |
| Chemat | 1kg | 630.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Thymidine is a pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. It has a role as a metabolite, a mouse metabolite, an Escherichia coli metabolite and a human metabolite. It is functionally related to a thymine. It is an enantiomer of a telbivudine.
Source: ChEBI
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)