cas: 50-89-5 — see every product listed under this CAS number, including other names
Thymidine, 97% (CAS 50-89-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 2g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078885-5G |
| cas | 50-89-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 2g | 91.65 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 96.86 Pln | |
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 529.00 Pln | |
| Fluorochem | 1kg | 966.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Thymidine is a pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. It has a role as a metabolite, a mouse metabolite, an Escherichia coli metabolite and a human metabolite. It is functionally related to a thymine. It is an enantiomer of a telbivudine.
Source: ChEBI
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)