cas: 1450-76-6 — see every product listed under this CAS number, including other names
2'-Hydroxy-5'-nitroacetophenone, 98%, 98% (CAS 1450-76-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KG0-1g |
| cas | 1450-76-6 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 352.40 Pln | |
| Chemat | 500g | 1555.20 Pln | |
| Chemat | 1kg | 3011.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(2-hydroxy-5-nitrophenyl)ethanone (CAS 1450-76-6) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 1-(2-hydroxy-5-nitrophenyl)ethanone. InChIKey: LNCBPUWMGYOISS-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 1-(2-hydroxy-5-nitrophenyl)ethanone |
| InChIKey | LNCBPUWMGYOISS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)