CAS 1450-76-6 appears in our catalog under these names: 2’-Hydroxy-5’-nitroacetophenone, 2'–Hydroxy–5'–nitroacetophenone, 2-Hydroxy-5-nitroacetophenone, 2'-Hydroxy-5'-nitroacetophenone, >98.0%(GC)(T), 1-(2-Hydroxy-5-nitrophenyl)ethanone 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 10g, 25g, 0,05kg, 1g, 5g, 0,1kg, 0,25kg.
1-(2-hydroxy-5-nitrophenyl)ethanone (CAS 1450-76-6) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 1-(2-hydroxy-5-nitrophenyl)ethanone. InChIKey: LNCBPUWMGYOISS-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 1-(2-hydroxy-5-nitrophenyl)ethanone |
| InChIKey | LNCBPUWMGYOISS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)