cas: 17556-18-2 — see every product listed under this CAS number, including other names
2(1H)-Naphthalenone, 6-chloro-3,4-dihydro-, 97%, 97% (CAS 17556-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11322J-100mg |
| cas | 17556-18-2 |
| size | 100mg |
| availability | 47g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| Chemat | 25g | 3506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-chloro-3,4-dihydro-1H-naphthalen-2-one (CAS 17556-18-2) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-1H-naphthalen-2-one. InChIKey: QQSYTUUAEZUAKL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | QQSYTUUAEZUAKL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)