CAS 343852-44-8 appears in our catalog under these names: 6-Chloro-2-methyl-1-indanone, 95%, 6–Chloro–2–methyl–2,3–dihydro–1H–inden–1–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
6-chloro-2-methyl-2,3-dihydroinden-1-one (CAS 343852-44-8) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-2-methyl-2,3-dihydroinden-1-one. InChIKey: GVWWIBFTRLTHMY-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | GVWWIBFTRLTHMY-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)