CAS 64220-40-2 appears in our catalog under these names: 5-Chloro-2-methyl-1-indanone, 95%, 5-Chloro-2-methyl-2,3-dihydro-1H-inden-1-one, 98%, 5-Chloro-2-methyl-2,3-dihydro-1H-inden-1-one, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-2-methyl-2,3-dihydroinden-1-one (CAS 64220-40-2) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 5-chloro-2-methyl-2,3-dihydroinden-1-one. InChIKey: RNMXBENXOQYACE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 5-chloro-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | RNMXBENXOQYACE-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)