CAS 66248-97-3 appears in our catalog under these names: 5-Chloro-3-methyl-2,3-dihydro-1h-inden-1-one, 95%, 5–Chloro–3–methyl–2,3–dihydro–1H–inden–1–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
5-chloro-3-methyl-2,3-dihydroinden-1-one (CAS 66248-97-3) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 5-chloro-3-methyl-2,3-dihydroinden-1-one. InChIKey: ZHPCICJTYBOCBJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 5-chloro-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | ZHPCICJTYBOCBJ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)