CAS 2942-06-5 appears in our catalog under these names: 6-Nitrobenzothiazole, 98%, 6-Nitrobenzothiazole, 6-Nitrobenzothiazole/ 98+%, 6-Nitrobenzothiazole, 98+% , 6-Nitro-1,3-benzothiazole, >98.0%(GC). Offered by: Combi-blocks, TRC, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 500g, 25g, 5g, 100g, 1g, 50g, 10g, 250g.
6-nitro-1,3-benzothiazole (CAS 2942-06-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 6-nitro-1,3-benzothiazole. InChIKey: QLUFBCVWKTWKBF-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 6-nitro-1,3-benzothiazole |
| InChIKey | QLUFBCVWKTWKBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC=N2 |
Computed by PubChem (NCBI)