CAS 757172-82-0 appears in our catalog under these names: Thiazolo[5,4-c]pyridine-2-carboxylic acid, 95%, Thiazolo(5,4-c)pyridine-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid (CAS 757172-82-0) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: [1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid. InChIKey: HNHHPCKKEOPKNX-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | [1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid |
| InChIKey | HNHHPCKKEOPKNX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1N=C(S2)C(=O)O |
Computed by PubChem (NCBI)