CAS 26579-59-9 appears in our catalog under these names: 3-Nitrothieno[3,2-b]pyridine, 95%, 3-Nitrothieno(3,2-b)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
3-nitrothieno[3,2-b]pyridine (CAS 26579-59-9) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 3-nitrothieno[3,2-b]pyridine. InChIKey: PZLPDVVGNDJTHK-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 3-nitrothieno[3,2-b]pyridine |
| InChIKey | PZLPDVVGNDJTHK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CS2)[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)