Products 635-54-1
CAS 635-54-1 appears in our catalog under these names: 2，2'–(Diazene–1，2–diyl)dibenzoic acid, 2,2'-(Diazene-1,2-diyl)dibenzoic acid, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(2-carboxyphenyl)diazenyl]benzoic acid (CAS 635-54-1) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 2-[(2-carboxyphenyl)diazenyl]benzoic acid. InChIKey: OOGKXQSCDZDEFV-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 2-[(2-carboxyphenyl)diazenyl]benzoic acid |
| InChIKey | OOGKXQSCDZDEFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N=NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)