CAS 145-49-3 appears in our catalog under these names: 1,5-Diamino-4,8-dihydroxyanthraquinone, 95%, 1,5–diamino–4,8–dihydroxyanthraquinone, 1,5-Diamino-4,8-dihydroxyanthraquinone, contain 1,8-Diamino-4,5-dihydroxyanthraquinone, 1,5-Diamino-4,8-dihydroxyanthracene-9,10-dione, 97%, 97%, 1,5-DIAMINO-4,8-DIHYDROXYANTHRAQUINONE, 97%(mixture of isomers). Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 1kg, 0,5kg, 250g, 500g.
1,5-diamino-4,8-dihydroxyanthracene-9,10-dione (CAS 145-49-3) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 1,5-diamino-4,8-dihydroxyanthracene-9,10-dione. InChIKey: HSYLKWSCFRLSKB-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 1,5-diamino-4,8-dihydroxyanthracene-9,10-dione |
| InChIKey | HSYLKWSCFRLSKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1N)C(=O)C3=C(C=CC(=C3C2=O)N)O)O |
Computed by PubChem (NCBI)