CAS 857785-14-9 appears in our catalog under these names: N-(3-Nitrodibenzo[b,d]furan-2-yl)acetamide, 95%, N-(3-Nitrodibenzo(b,d)furan-2-yl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
N-(3-nitrodibenzofuran-2-yl)acetamide (CAS 857785-14-9) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: N-(3-nitrodibenzofuran-2-yl)acetamide. InChIKey: NLPYRTDNEMYVHY-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | N-(3-nitrodibenzofuran-2-yl)acetamide |
| InChIKey | NLPYRTDNEMYVHY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C2C(=C1)C3=CC=CC=C3O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)