CAS 854163-25-0 is the registry number for 2-(2-Nitrophenyl)-2,3-dihydro-4h-1,3-benzoxazin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-nitrophenyl)-2,3-dihydro-1,3-benzoxazin-4-one (CAS 854163-25-0) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 2-(2-nitrophenyl)-2,3-dihydro-1,3-benzoxazin-4-one. InChIKey: TVZXSLSWFREWHN-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 2-(2-nitrophenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
| InChIKey | TVZXSLSWFREWHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2NC(=O)C3=CC=CC=C3O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)