Products 2651971-31-0
CAS 2651971-31-0 is the registry number for 1-(Methoxycarbonyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methoxycarbonyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 2651971-31-0) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 1-methoxycarbonyl-9H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: KSWAIDQYYJKSOJ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 1-methoxycarbonyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | KSWAIDQYYJKSOJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=N1)C(=O)O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)