Products 249283-74-7
CAS 249283-74-7 is the registry number for (E)-3,3'-(Diazene-1,2-diyl)dibenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-[(3-carboxyphenyl)diazenyl]benzoic acid (CAS 249283-74-7) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 3-[(3-carboxyphenyl)diazenyl]benzoic acid. InChIKey: QBVIXYABUQQSRY-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 3-[(3-carboxyphenyl)diazenyl]benzoic acid |
| InChIKey | QBVIXYABUQQSRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=NC2=CC=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Azobenzene-3,3'-dicarboxylic Acid, 3,3'-Azodibenzoic Acid, 3,3'-(Diazene-1,2-diyl)dibenzoic acid, (E)-3,3'-(diazene-1,2-diyl)dibenzoic acid, 3-[(3-carboxyphenyl)diazenyl]benzoic acid, 3-[(1E)-2-(3-carboxyphenyl)diazen-1-yl]benzoic acid, Benzoic acid, 3,3'-azobis-, 3,3-Azodibenzoic Acid, QBVIXYABUQQSRY-FOCLMDBBSA-N, QBVIXYABUQQSRY-UHFFFAOYSA-N