CAS 313986-04-8 is the registry number for 3-(4-Nitrobenzyl)-1,3-benzoxazol-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(4-nitrophenyl)methyl]-1,3-benzoxazol-2-one (CAS 313986-04-8) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 3-[(4-nitrophenyl)methyl]-1,3-benzoxazol-2-one. InChIKey: LJQPVRSJTZNENL-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 3-[(4-nitrophenyl)methyl]-1,3-benzoxazol-2-one |
| InChIKey | LJQPVRSJTZNENL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)O2)CC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)