cas: 54996-07-5 — see every product listed under this CAS number, including other names
2,2,6,6-Tetramethylpiperidine-4-carboxylic acid hydrochloride, 95% (CAS 54996-07-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A497665-1g |
| cas | 54996-07-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6898.99 Pln | |
| Fluorochem | 250mg | 4064.21 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride (CAS 54996-07-5) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: QSWMAXHNUDWBLI-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | QSWMAXHNUDWBLI-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)C(=O)O)C.Cl |
Computed by PubChem (NCBI)