CAS 54996-07-5 appears in our catalog under these names: 2,2,6,6-Tetramethylpiperidine-4-carboxylic acid, hydrochloride salt, 95%, 2,2,6,6-Tetramethylpiperidine-4-carboxylic acid hydrochloride, 95%, 2,2,6,6-TETRAMETHYLPIPERIDINE-4-CARBOXYLIC ACID HCL. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg.
2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride (CAS 54996-07-5) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: QSWMAXHNUDWBLI-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | QSWMAXHNUDWBLI-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)C(=O)O)C.Cl |
Computed by PubChem (NCBI)