Products 1922694-67-4

CAS 1922694-67-4 is the registry number for 1-Piperidineacetic acid, alpha,3,5-trimethyl-, hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-dimethylpiperidin-1-yl)propanoic acid;hydrochloride (CAS 1922694-67-4) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2-(3,5-dimethylpiperidin-1-yl)propanoic acid;hydrochloride. InChIKey: ROJQVYFKSSQXLO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name2-(3,5-dimethylpiperidin-1-yl)propanoic acid;hydrochloride
InChIKeyROJQVYFKSSQXLO-UHFFFAOYSA-N
SMILESCC1CC(CN(C1)C(C)C(=O)O)C.Cl

Computed by PubChem (NCBI)