CAS 1922694-67-4 is the registry number for 1-Piperidineacetic acid, alpha,3,5-trimethyl-, hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-(3,5-dimethylpiperidin-1-yl)propanoic acid;hydrochloride (CAS 1922694-67-4) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2-(3,5-dimethylpiperidin-1-yl)propanoic acid;hydrochloride. InChIKey: ROJQVYFKSSQXLO-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 2-(3,5-dimethylpiperidin-1-yl)propanoic acid;hydrochloride |
| InChIKey | ROJQVYFKSSQXLO-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)C(C)C(=O)O)C.Cl |
Computed by PubChem (NCBI)