Products 1609401-04-8

CAS 1609401-04-8 is the registry number for (1-Propyl-4-piperidinyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(1-propylpiperidin-4-yl)acetic acid;hydrochloride (CAS 1609401-04-8) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2-(1-propylpiperidin-4-yl)acetic acid;hydrochloride. InChIKey: VGDNDYGUSXGOLC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name2-(1-propylpiperidin-4-yl)acetic acid;hydrochloride
InChIKeyVGDNDYGUSXGOLC-UHFFFAOYSA-N
SMILESCCCN1CCC(CC1)CC(=O)O.Cl

Computed by PubChem (NCBI)