Products 1820571-76-3

CAS 1820571-76-3 is the registry number for 3-[Cis-2,6-dimethyl-1-piperidinyl]propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanoic acid;hydrochloride (CAS 1820571-76-3) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanoic acid;hydrochloride. InChIKey: RNNDSXWFHOKNOX-UFIFRZAQSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanoic acid;hydrochloride
InChIKeyRNNDSXWFHOKNOX-UFIFRZAQSA-N
SMILESC[C@@H]1CCC[C@@H](N1CCC(=O)O)C.Cl

Computed by PubChem (NCBI)