CAS 1820571-76-3 is the registry number for 3-[Cis-2,6-dimethyl-1-piperidinyl]propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanoic acid;hydrochloride (CAS 1820571-76-3) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanoic acid;hydrochloride. InChIKey: RNNDSXWFHOKNOX-UFIFRZAQSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanoic acid;hydrochloride |
| InChIKey | RNNDSXWFHOKNOX-UFIFRZAQSA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1CCC(=O)O)C.Cl |
Computed by PubChem (NCBI)