Products 1087728-65-1

CAS 1087728-65-1 is the registry number for 3-(1-Ethyl-piperidin-4-yl)-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 2g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(1-ethylpiperidin-4-yl)propanoic acid;hydrochloride (CAS 1087728-65-1) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 3-(1-ethylpiperidin-4-yl)propanoic acid;hydrochloride. InChIKey: QGMVIWAMYDVJNN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name3-(1-ethylpiperidin-4-yl)propanoic acid;hydrochloride
InChIKeyQGMVIWAMYDVJNN-UHFFFAOYSA-N
SMILESCCN1CCC(CC1)CCC(=O)O.Cl

Computed by PubChem (NCBI)