Products 49637-20-9

CAS 49637-20-9 appears in our catalog under these names: 5-(Piperidin-1-yl)pentanoic acid hydrochloride, 95%, 5–(Piperidin–1–yl)pentanoic acid hydrochloride, 5-(Piperidin-1-yl)pentanoic acid hydrochloride, 5-(Piperidin-1-yl)pentanoic acid hydrochloride 95%, 5-(Piperidin-1-yl)pentanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-piperidin-1-ylpentanoic acid;hydrochloride (CAS 49637-20-9) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 5-piperidin-1-ylpentanoic acid;hydrochloride. InChIKey: DHPWBXBFXOJSNL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name5-piperidin-1-ylpentanoic acid;hydrochloride
InChIKeyDHPWBXBFXOJSNL-UHFFFAOYSA-N
SMILESC1CCN(CC1)CCCCC(=O)O.Cl

Computed by PubChem (NCBI)