CAS 652-29-9 appears in our catalog under these names: 2',3',4',5',6'–Pentafluoroacetophenone, 2,3,4,5,6-Pentafluoroacetophenone/ 97+%, 2',3',4',5',6'-Pentafluoroacetophenone, >98.0%(GC), 2',3',4',5',6'-Pentafluoroacetophenone 98%, 2',3',4',5',6'-Pentafluoroacetophenone, 97%. Offered by: GLPBio, Chemat, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
1-(2,3,4,5,6-pentafluorophenyl)ethanone (CAS 652-29-9) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(2,3,4,5,6-pentafluorophenyl)ethanone. InChIKey: FBGHCYZBCMDEOX-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| InChIKey | FBGHCYZBCMDEOX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)