cas: 61079-72-9 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzoic acid (CAS 61079-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 50g, 250g, 1000g, 2000g, 1g, 5g, 25g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FT37840-100g |
| cas | 61079-72-9 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 100g | price on request | |
| Biosynth | 50g | price on request | |
| Biosynth | 250g | price on request | |
| Biosynth | 1000g | price on request | |
| Biosynth | 2000g | price on request | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 404.04 Pln | |
| Fluorochem | 500g | 1794.18 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| sub-category 2 | Benzoic Acids and Esters |
| purity | No data |
| delivery time | To be confirmed by Chemat |
2,3,4-trifluorobenzoic acid (CAS 61079-72-9) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,4-trifluorobenzoic acid. InChIKey: WEPXLRANFJEOFZ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoic acid |
| InChIKey | WEPXLRANFJEOFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)F |
Computed by PubChem (NCBI)