cas: 61079-72-9 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzoic acid, 98.00% (CAS 61079-72-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM51230K-25g |
| cas | 61079-72-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 674.59 Pln | |
| Chemat | 5g | 212.94 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
2,3,4-trifluorobenzoic acid (CAS 61079-72-9) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,4-trifluorobenzoic acid. InChIKey: WEPXLRANFJEOFZ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoic acid |
| InChIKey | WEPXLRANFJEOFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)F |
Computed by PubChem (NCBI)