cas: 61079-72-9 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzoic Acid, >98.0%(GC)(T) (CAS 61079-72-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1867-1G |
| cas | 61079-72-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 5g | 172.43 Pln | |
| TCI | 25g | 501.89 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,3,4-trifluorobenzoic acid (CAS 61079-72-9) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,4-trifluorobenzoic acid. InChIKey: WEPXLRANFJEOFZ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoic acid |
| InChIKey | WEPXLRANFJEOFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)F |
Computed by PubChem (NCBI)