cas: 61079-72-9 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzoic acid, 98%, 98% (CAS 61079-72-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143X7-1g |
| cas | 61079-72-9 |
| size | 1g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 50g | 141.20 Pln | |
| Chemat | 100g | 218.00 Pln | |
| Chemat | 250g | 438.80 Pln | |
| Chemat | 500g | 820.80 Pln | |
| Chemat | 1kg | 1523.60 Pln | |
| Chemat | 5kg | 6172.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,4-trifluorobenzoic acid (CAS 61079-72-9) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,4-trifluorobenzoic acid. InChIKey: WEPXLRANFJEOFZ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoic acid |
| InChIKey | WEPXLRANFJEOFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)F |
Computed by PubChem (NCBI)