cas: 43020-38-8 — see every product listed under this CAS number, including other names
2,3,4-Trimethoxybenzonitrile, >98.0%(GC) (CAS 43020-38-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3285-5G |
| cas | 43020-38-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 316.52 Pln | |
| TCI | 25g | 852.50 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,3,4-trimethoxybenzonitrile (CAS 43020-38-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2,3,4-trimethoxybenzonitrile. InChIKey: YCSGHMDKBZNXJC-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2,3,4-trimethoxybenzonitrile |
| InChIKey | YCSGHMDKBZNXJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C#N)OC)OC |
Computed by PubChem (NCBI)