cas: 43020-38-8 — see every product listed under this CAS number, including other names
2,3,4-Trimethoxybenzonitrile, 98%, 98% (CAS 43020-38-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FEB-5g |
| cas | 43020-38-8 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 328.40 Pln | |
| Chemat | 25g | 707.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,4-trimethoxybenzonitrile (CAS 43020-38-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2,3,4-trimethoxybenzonitrile. InChIKey: YCSGHMDKBZNXJC-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2,3,4-trimethoxybenzonitrile |
| InChIKey | YCSGHMDKBZNXJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C#N)OC)OC |
Computed by PubChem (NCBI)