cas: 1384157-92-9 — see every product listed under this CAS number, including other names
2,3,5-Trifluorocinnamic acid (CAS 1384157-92-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007971-1G |
| cas | 1384157-92-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln |
| delivery time | 2-3 weeks |
|---|
(E)-3-(2,3,5-trifluorophenyl)prop-2-enoic acid (CAS 1384157-92-9) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: (E)-3-(2,3,5-trifluorophenyl)prop-2-enoic acid. InChIKey: FHDPERUKPYYNEO-OWOJBTEDSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | (E)-3-(2,3,5-trifluorophenyl)prop-2-enoic acid |
| InChIKey | FHDPERUKPYYNEO-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1/C=C/C(=O)O)F)F)F |
Computed by PubChem (NCBI)