Products 152152-19-7
CAS 152152-19-7 appears in our catalog under these names: 3,4,5–Trifluorocinnamic acid, 3,4,5-Trifluorocinnamic acid 98% (E), 3,4,5-Trifluorocinnamic acid, 98% (E), 98% (E), 3,4,5-Trifluorocinnamic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 10g.
3-(3,4,5-trifluorophenyl)prop-2-enoic acid (CAS 152152-19-7) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 3-(3,4,5-trifluorophenyl)prop-2-enoic acid. InChIKey: PHIWFMZBVZFEQJ-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 3-(3,4,5-trifluorophenyl)prop-2-enoic acid |
| InChIKey | PHIWFMZBVZFEQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C=CC(=O)O |
Computed by PubChem (NCBI)