CAS 36750-88-6 is the registry number for 3,3,3-Trifluoro-1-phenylpropane-1,2-dione, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,3,3-trifluoro-1-phenylpropane-1,2-dione (CAS 36750-88-6) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 3,3,3-trifluoro-1-phenylpropane-1,2-dione. InChIKey: UXHRDSOEZXQJIO-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-phenylpropane-1,2-dione |
| InChIKey | UXHRDSOEZXQJIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)