Products 331245-88-6
CAS 331245-88-6 appears in our catalog under these names: (E)-3-(3,4,5-Trifluorophenyl)acrylic acid, 98%, 3-(3,4,5-Trifluorophenyl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(E)-3-(3,4,5-trifluorophenyl)prop-2-enoic acid (CAS 331245-88-6) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: (E)-3-(3,4,5-trifluorophenyl)prop-2-enoic acid. InChIKey: PHIWFMZBVZFEQJ-OWOJBTEDSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | (E)-3-(3,4,5-trifluorophenyl)prop-2-enoic acid |
| InChIKey | PHIWFMZBVZFEQJ-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)