cas: 36873-96-8 — see every product listed under this CAS number, including other names
2,3,5-trimethoxybenzoic acid, 97%, 97% (CAS 36873-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CL96-100mg |
| cas | 36873-96-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 500mg | 1096.40 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3,5-trimethoxybenzoic acid (CAS 36873-96-8) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2,3,5-trimethoxybenzoic acid. InChIKey: SRLTVIITBRPPCB-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,3,5-trimethoxybenzoic acid |
| InChIKey | SRLTVIITBRPPCB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)